Attributes
UniProt ID
Protein Name
Chlorophyll a-b binding protein 8, chloroplastic
Ligand Name
(1R,3R)-6-{(3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1S,4R,6R)-4-HYDROXY-2,2,6-TRIMETHYL-7-OXABICYCLO[4.1.0]HEPT-1-YL]-3,7,12,16-TETRAMETHYLOCTADECA-1,3,5,7,9,11,13,15,17-NONAENYLIDENE}-1,5,5-TRIMETHYLCYCLOHEXANE-1,3-DIOL
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PGYAYSRVSAJXTE-OQASCVKESA-N
SMILES
CC(=CC=CC=C(C)C=CC=C(C)C=C=C1C(CC(CC1(C)O)O)(C)C)C=CC=C(C)C=CC23C(CC(CC2(O3)C)O)(C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5XNL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5xnl11e5xnl21e5xnl31e5xnl41e5xnl51e5xnl61e5xnl71e5xnl81e5xnlA1e5xnlB1e5xnlB2e5xnlC1e5xnlD1e5xnlE1e5xnlF1e5xnlG1e5xnlH1e5xnlI1e5xnlJ1e5xnlK1e5xnlL1e5xnlM1e5xnlN1e5xnlO1e5xnlP1e5xnlQ1e5xnlR1e5xnlS1e5xnlT1e5xnlW1e5xnlX1e5xnlY1e5xnlZ1e5xnla1e5xnlb1e5xnlb2e5xnlc1e5xnld1e5xnle1e5xnlf1e5xnlg1e5xnlh1e5xnli1e5xnlj1e5xnlk1e5xnll1e5xnlm1e5xnln1e5xnlo1e5xnlp1e5xnlq1e5xnlr1e5xnls1e5xnlt1e5xnlw1e5xnlx1e5xnly1e5xnlz1
ECOD domains from experimental PDB structures interacting with ligand NEX
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P27490 | n/a | NEX | 5xnl | e5xnl11 | 1:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnl21 | 2:14-231 |
| P27490 | n/a | NEX | 5xnl | e5xnl51 | 5:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnl61 | 6:14-231 |
| P27490 | n/a | NEX | 5xnl | e5xnlG1 | G:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnlN1 | N:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnlY1 | Y:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnlg1 | g:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnln1 | n:13-231 |
| P27490 | n/a | NEX | 5xnl | e5xnly1 | y:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnm11 | 1:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnm21 | 2:14-231 |
| P27490 | n/a | NEX | 5xnm | e5xnm51 | 5:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnm61 | 6:14-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmG1 | G:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmN1 | N:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmY1 | Y:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmg1 | g:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmn1 | n:13-231 |
| P27490 | n/a | NEX | 5xnm | e5xnmy1 | y:13-231 |
| P27490 | n/a | NEX | 5xnn | e5xnn11 | 1:13-231 |
| P27490 | n/a | NEX | 5xnn | e5xnn21 | 2:14-231 |
| P27490 | n/a | NEX | 5xno | e5xno11 | 1:13-231 |
| P27490 | n/a | NEX | 5xno | e5xno21 | 2:14-231 |
| P27490 | n/a | NEX | 6yp7 | e6yp7N1 | N:13-231 |
| P27490 | n/a | NEX | 6yp7 | e6yp7Y1 | Y:13-231 |
| P27490 | n/a | NEX | 6yp7 | e6yp7g1 | g:13-231 |
| P27490 | n/a | NEX | 6yp7 | e6yp7n1 | n:13-231 |
| P27490 | n/a | NEX | 6yp7 | e6yp7y1 | y:13-231 |