Attributes
UniProt ID
Protein Name
Multifunctional protein CAD
Ligand Name
N-CARBAMOYL-L-ASPARTATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HLKXYZVTANABHZ-REOHCLBHSA-N
SMILES
C(C(C(=O)O)NC(=O)N)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4C6D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4c6dA1e4c6dA2
ECOD domains from experimental PDB structures interacting with ligand DB04252
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P27708 | DB04252 | NCD | 4c6d | e4c6dA2 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 4c6e | e4c6eA2 | A:1466-1742,A:1797-1823 |
| P27708 | DB04252 | NCD | 4c6f | e4c6fA2 | A:1466-1742,A:1797-1823 |
| P27708 | DB04252 | NCD | 4c6i | e4c6iA1 | A:1466-1742,A:1797-1822 |
| P27708 | DB04252 | NCD | 4c6j | e4c6jA2 | A:1466-1742,A:1797-1822 |
| P27708 | DB04252 | NCD | 4c6k | e4c6kA1 | A:1466-1742,A:1797-1822 |
| P27708 | DB04252 | NCD | 4c6n | e4c6nA2 | A:1466-1742,A:1797-1823 |
| P27708 | DB04252 | NCD | 4c6q | e4c6qA2 | A:1466-1742,A:1797-1822 |
| P27708 | DB04252 | NCD | 6hfr | e6hfrA2 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 6hfs | e6hfsA1 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 6hfu | e6hfuA2 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 8pbe | e8pbeA1 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 8pbh | e8pbhA1 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 8pbj | e8pbjA1 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 8pbp | e8pbpA2 | A:1466-1742,A:1797-1821 |
| P27708 | DB04252 | NCD | 8pbq | e8pbqA1 | A:1466-1742,A:1797-1813 |