Attributes
UniProt ID
Protein Name
Glutathione S-transferase Mu 2
Ligand Name
GLUTATHIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RWSXRVCMGQZWBV-WDSKDSINSA-N
SMILES
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XW5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xw5A1e1xw5A2e1xw5B1e1xw5B2
ECOD domains from experimental PDB structures interacting with ligand DB00143
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P28161 | DB00143 | GSH | 1xw5 | e1xw5A1 | A:85-217 |
| P28161 | DB00143 | GSH | 1xw5 | e1xw5A2 | A:1-84 |
| P28161 | DB00143 | GSH | 1xw5 | e1xw5B1 | B:85-217 |
| P28161 | DB00143 | GSH | 1xw5 | e1xw5B2 | B:1-84 |
| P28161 | DB00143 | GSH | 3gur | e3gurA1 | A:85-217 |
| P28161 | DB00143 | GSH | 3gur | e3gurB1 | B:85-216 |
| P28161 | DB00143 | GSH | 3gur | e3gurB2 | B:1-84 |
| P28161 | DB00143 | GSH | 3gur | e3gurC1 | C:85-217 |
| P28161 | DB00143 | GSH | 3gur | e3gurD1 | D:85-217 |
| P28161 | DB00143 | GSH | 3gur | e3gurD2 | D:1-84 |
| P28161 | DB00143 | GSH | 5hwl | e5hwlA1 | A:85-217 |
| P28161 | DB00143 | GSH | 5hwl | e5hwlA2 | A:1-84 |
| P28161 | DB00143 | GSH | 5hwl | e5hwlB1 | B:85-217 |
| P28161 | DB00143 | GSH | 5hwl | e5hwlB2 | B:2-84 |