Attributes
UniProt ID
Protein Name
5-hydroxytryptamine receptor 2A
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6A93
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6a93A1e6a93A2e6a93B1e6a93B2
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P28223 | DB04540 | CLR | 6a93 | e6a93A2 | A:69-1005,A:1105-399 |
| P28223 | DB04540 | CLR | 6a93 | e6a93B1 | B:72-1005,B:1105-401 |
| P28223 | DB04540 | CLR | 6a94 | e6a94A2 | A:69-1005,A:1105-399 |
| P28223 | DB04540 | CLR | 6a94 | e6a94B1 | B:72-1005,B:1105-401 |
| P28223 | DB04540 | CLR | 6wgt | e6wgtA1 | A:72-1005,A:312-399 |
| P28223 | DB04540 | CLR | 6wh4 | e6wh4A2 | A:71-1005,A:312-399 |
| P28223 | DB04540 | CLR | 6wh4 | e6wh4C2 | C:69-1005,C:312-398 |
| P28223 | DB04540 | CLR | 7vod | e7vodA1 | A:74-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7voe | e7voeA1 | A:74-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc4 | e7wc4A1 | A:67-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc5 | e7wc5A1 | A:67-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc6 | e7wc6A1 | A:74-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc7 | e7wc7A2 | A:71-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc8 | e7wc8A2 | A:70-1005,A:1105-401 |
| P28223 | DB04540 | CLR | 7wc9 | e7wc9A1 | A:71-1005,A:1105-401 |