Attributes
UniProt ID
Protein Name
dCTP deaminase
Ligand Name
DEOXYURIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AHCYMLUZIRLXAA-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XS1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xs1A1e1xs1B1e1xs1C1e1xs1D1e1xs1E1e1xs1F1
ECOD domains from experimental PDB structures interacting with ligand DB02333
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P28248 | DB02333 | DUT | 1xs1 | e1xs1A1 | A:1-193 |
| P28248 | DB02333 | DUT | 1xs1 | e1xs1B1 | B:1-193 |
| P28248 | DB02333 | DUT | 1xs1 | e1xs1C1 | C:1-193 |
| P28248 | DB02333 | DUT | 1xs1 | e1xs1D1 | D:1-193 |
| P28248 | DB02333 | DUT | 1xs1 | e1xs1E1 | E:1-193 |
| P28248 | DB02333 | DUT | 1xs1 | e1xs1F1 | F:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6A1 | A:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6B1 | B:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6C1 | C:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6D1 | D:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6E1 | E:1-193 |
| P28248 | DB02333 | DUT | 1xs6 | e1xs6F1 | F:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xA1 | A:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xB1 | B:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xC1 | C:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xD1 | D:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xE1 | E:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xF1 | F:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xG1 | G:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xH1 | H:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xI1 | I:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xJ1 | J:1-171 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xK1 | K:1-193 |
| P28248 | DB02333 | DUT | 2v9x | e2v9xL1 | L:1-174 |