Attributes
UniProt ID
Protein Name
CTP synthase 1
Ligand Name
CYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PCDQPRRSZKQHHS-XVFCMESISA-N
SMILES
C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7RMC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7rmcD1e7rmcD2e7rmcE1e7rmcE2e7rmcF1e7rmcF2e7rmcQ1e7rmcQ2e7rmcR1e7rmcR2e7rmcS1e7rmcS2e7rmcT1e7rmcT2e7rmcU1e7rmcU2e7rmcV1e7rmcV2e7rmcW1e7rmcW2e7rmcg1e7rmcg2e7rmch1e7rmch2
ECOD domains from experimental PDB structures interacting with ligand DB02431
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P28274 | DB02431 | CTP | 7rmc | e7rmcD1 | D:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcD2 | D:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcE1 | E:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcE2 | E:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcF1 | F:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcF2 | F:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcQ1 | Q:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcQ2 | Q:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcR1 | R:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcR2 | R:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcS1 | S:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcS2 | S:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcT1 | T:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcT2 | T:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcU1 | U:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcU2 | U:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcV1 | V:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcV2 | V:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcW1 | W:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcW2 | W:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcg1 | g:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmcg2 | g:302-572 |
| P28274 | DB02431 | CTP | 7rmc | e7rmch1 | h:1-301 |
| P28274 | DB02431 | CTP | 7rmc | e7rmch2 | h:302-572 |