Attributes
UniProt ID
Protein Name
Fatty acid oxidation complex subunit alpha
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1WDK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1wdkA1e1wdkA2e1wdkA3e1wdkA4e1wdkB1e1wdkB2e1wdkB3e1wdkB4e1wdkC1e1wdkC2e1wdkD1e1wdkD2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P28793 | DB14128 | NAD | 1wdk | e1wdkA3 | A:311-496 |
| P28793 | DB14128 | NAD | 1wdk | e1wdkB3 | B:311-496 |
| P28793 | DB14128 | NAD | 1wdl | e1wdlA3 | A:311-496 |
| P28793 | DB14128 | NAD | 1wdl | e1wdlB1 | B:497-620 |
| P28793 | DB14128 | NAD | 1wdl | e1wdlB3 | B:311-496 |
| P28793 | DB14128 | NAD | 1wdm | e1wdmA1 | A:497-620 |
| P28793 | DB14128 | NAD | 1wdm | e1wdmA3 | A:311-496 |
| P28793 | DB14128 | NAD | 1wdm | e1wdmB1 | B:497-620 |
| P28793 | DB14128 | NAD | 1wdm | e1wdmB3 | B:311-496 |
| P28793 | DB14128 | NAD | 2d3t | e2d3tA1 | A:497-620 |
| P28793 | DB14128 | NAD | 2d3t | e2d3tA3 | A:311-496 |
| P28793 | DB14128 | NAD | 2d3t | e2d3tB1 | B:497-620 |
| P28793 | DB14128 | NAD | 2d3t | e2d3tB3 | B:311-496 |