Attributes
UniProt ID
Protein Name
Photosystem I P700 chlorophyll a apoprotein A2
Ligand Name
BETA-CAROTENE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OENHQHLEOONYIE-JLTXGRSLSA-N
SMILES
CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5OY0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5oy001e5oy011e5oy012e5oy021e5oy022e5oy031e5oy041e5oy051e5oy061e5oy071e5oy081e5oy091e5oy0A1e5oy0A2e5oy0B1e5oy0B2e5oy0C1e5oy0D1e5oy0E1e5oy0F1e5oy0I1e5oy0J1e5oy0K1e5oy0L1e5oy0M1e5oy0a1e5oy0a2e5oy0b1e5oy0b2e5oy0c1e5oy0d1e5oy0e1e5oy0f1e5oy0h1e5oy0i1e5oy0j1e5oy0k1e5oy0l1e5oy0m1
ECOD domains from experimental PDB structures interacting with ligand DB06755
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29255 | DB06755 | BCR | 5oy0 | e5oy021 | 2:1-402 |
| P29255 | DB06755 | BCR | 5oy0 | e5oy022 | 2:403-731 |
| P29255 | DB06755 | BCR | 5oy0 | e5oy0B2 | B:403-731 |
| P29255 | DB06755 | BCR | 5oy0 | e5oy0b1 | b:403-731 |
| P29255 | DB06755 | BCR | 6hqb | e6hqbB1 | B:1-402 |
| P29255 | DB06755 | BCR | 6hqb | e6hqbB2 | B:403-731 |
| P29255 | DB06755 | BCR | 6nwa | e6nwaB1 | B:403-731 |
| P29255 | DB06755 | BCR | 6nwa | e6nwaB2 | B:3-402 |
| P29255 | DB06755 | BCR | 6nwa | e6nwaG1 | G:403-731 |
| P29255 | DB06755 | BCR | 6nwa | e6nwaG2 | G:3-402 |
| P29255 | DB06755 | BCR | 6nwa | e6nwab1 | b:403-731 |
| P29255 | DB06755 | BCR | 6nwa | e6nwab2 | b:3-402 |
| P29255 | DB06755 | BCR | 7o1v | e7o1vB1 | B:3-402 |
| P29255 | DB06755 | BCR | 7o1v | e7o1vB2 | B:403-731 |
| P29255 | DB06755 | BCR | 7umh | e7umhB1 | B:403-731 |
| P29255 | DB06755 | BCR | 7umh | e7umhG1 | G:403-731 |
| P29255 | DB06755 | BCR | 7umh | e7umhG2 | G:2-402 |
| P29255 | DB06755 | BCR | 7umh | e7umhb1 | b:403-731 |
| P29255 | DB06755 | BCR | 8am5 | e8am5b1 | b:3-402 |
| P29255 | DB06755 | BCR | 8am5 | e8am5b2 | b:403-731 |
| P29255 | DB06755 | BCR | 8asl | e8aslb1 | b:3-402 |
| P29255 | DB06755 | BCR | 8asl | e8aslb2 | b:403-731 |
| P29255 | DB06755 | BCR | 8asp | e8aspb1 | b:3-402 |
| P29255 | DB06755 | BCR | 8asp | e8aspb2 | b:403-731 |