Attributes
UniProt ID
Protein Name
Photosystem I reaction center subunit III
Ligand Name
CHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES
CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5OY0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5oy001e5oy011e5oy012e5oy021e5oy022e5oy031e5oy041e5oy051e5oy061e5oy071e5oy081e5oy091e5oy0A1e5oy0A2e5oy0B1e5oy0B2e5oy0C1e5oy0D1e5oy0E1e5oy0F1e5oy0I1e5oy0J1e5oy0K1e5oy0L1e5oy0M1e5oy0a1e5oy0a2e5oy0b1e5oy0b2e5oy0c1e5oy0d1e5oy0e1e5oy0f1e5oy0h1e5oy0i1e5oy0j1e5oy0k1e5oy0l1e5oy0m1
ECOD domains from experimental PDB structures interacting with ligand DB02133
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29256 | DB02133 | CLA | 5oy0 | e5oy061 | 6:1-143 |
| P29256 | DB02133 | CLA | 5oy0 | e5oy0F1 | F:1-143 |
| P29256 | DB02133 | CLA | 5oy0 | e5oy0f1 | f:1-143 |
| P29256 | DB02133 | CLA | 6hqb | e6hqbF1 | F:1-143 |
| P29256 | DB02133 | CLA | 6nwa | e6nwaF1 | F:5-143 |
| P29256 | DB02133 | CLA | 6nwa | e6nwaQ1 | Q:5-143 |
| P29256 | DB02133 | CLA | 6nwa | e6nwaf1 | f:5-143 |
| P29256 | DB02133 | CLA | 6uzv | e6uzv61 | 6:3-143 |
| P29256 | DB02133 | CLA | 6uzv | e6uzvF1 | F:3-143 |
| P29256 | DB02133 | CLA | 6uzv | e6uzvf1 | f:3-143 |
| P29256 | DB02133 | CLA | 7umh | e7umhF1 | F:3-143 |
| P29256 | DB02133 | CLA | 7umh | e7umhQ1 | Q:3-143 |
| P29256 | DB02133 | CLA | 7umh | e7umhf1 | f:3-143 |
| P29256 | DB02133 | CLA | 8am5 | e8am5f1 | f:24-165 |
| P29256 | DB02133 | CLA | 8asl | e8aslf1 | f:24-165 |
| P29256 | DB02133 | CLA | 8asp | e8aspf1 | f:24-165 |