Attributes
UniProt ID
Protein Name
Adenosine receptor A2a
Ligand Name
(2S)-2,3-dihydroxypropyl (9Z)-octadec-9-enoate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RZRNAYUHWVFMIP-QJRAZLAKSA-N
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4EIY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4eiyA2e4eiyA3
ECOD domains from experimental PDB structures interacting with ligand OLB
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29274 | n/a | OLB | 4eiy | e4eiyA3 | A:-1-1005,A:221-307 |
| P29274 | n/a | OLB | 4ug2 | e4ug2A1 | A:6-309 |
| P29274 | n/a | OLB | 4ug2 | e4ug2B1 | B:6-305 |
| P29274 | n/a | OLB | 5iu4 | e5iu4A1 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 5iu7 | e5iu7A1 | A:-3-1005,A:221-307 |
| P29274 | n/a | OLB | 5iu8 | e5iu8A2 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 5iua | e5iuaA2 | A:-1-1005,A:221-306 |
| P29274 | n/a | OLB | 5iub | e5iubA2 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 5jtb | e5jtbA1 | A:-1-1005,A:221-307 |
| P29274 | n/a | OLB | 5k2b | e5k2bA1 | A:-2-1005,A:221-308 |
| P29274 | n/a | OLB | 5k2d | e5k2dA2 | A:-2-1005,A:221-308 |
| P29274 | n/a | OLB | 5nm2 | e5nm2A1 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 5vra | e5vraA2 | A:-1-1005,A:221-307 |
| P29274 | n/a | OLB | 6aqf | e6aqfA1 | A:-2-1005,A:221-306 |
| P29274 | n/a | OLB | 6ps7 | e6ps7A1 | A:-2-1005,A:221-308 |
| P29274 | n/a | OLB | 6s0l | e6s0lA2 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 6s0q | e6s0qA1 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 6wqa | e6wqaA1 | A:-2-1005,A:221-308 |
| P29274 | n/a | OLB | 6zdv | e6zdvA1 | A:0-1005,A:221-305 |
| P29274 | n/a | OLB | 8c9w | e8c9wA1 | A:-1-1005,A:221-307 |
| P29274 | n/a | OLB | 8cic | e8cicA1 | A:-1-1005,A:221-305 |
| P29274 | n/a | OLB | 8fyn | e8fynA1 | A:-1-1005,A:221-307 |