Attributes
UniProt ID
Protein Name
DNA replication licensing factor MCM2
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5U8S
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5u8s21e5u8s23e5u8s24e5u8s25e5u8s26e5u8s31e5u8s32e5u8s33e5u8s34e5u8s35e5u8s41e5u8s42e5u8s43e5u8s44e5u8s45e5u8s46e5u8s51e5u8s52e5u8s54e5u8s55e5u8s56e5u8s61e5u8s62e5u8s63e5u8s64e5u8s65e5u8s71e5u8s72e5u8s73e5u8s74e5u8s75e5u8sA1e5u8sA2e5u8sB1e5u8sB2e5u8sC1e5u8sC2e5u8sD1e5u8sD2e5u8sE1e5u8sE2e5u8sE3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29469 | DB00171 | ATP | 5u8s | e5u8s25 | 2:471-706 |
| P29469 | DB00171 | ATP | 5u8s | e5u8s26 | 2:756-864 |
| P29469 | DB00171 | ATP | 6ptn | e6ptn22 | 2:737-864 |
| P29469 | DB00171 | ATP | 6ptn | e6ptn23 | 2:464-706 |
| P29469 | DB00171 | ATP | 6ptn | e6ptni2 | i:737-864 |
| P29469 | DB00171 | ATP | 6ptn | e6ptni3 | i:464-706 |
| P29469 | DB00171 | ATP | 6pto | e6pto22 | 2:737-864 |
| P29469 | DB00171 | ATP | 6pto | e6pto25 | 2:464-706 |
| P29469 | DB00171 | ATP | 6pto | e6ptoh3 | h:737-864 |
| P29469 | DB00171 | ATP | 6pto | e6ptoh4 | h:464-706 |
| P29469 | DB00171 | ATP | 6u0m | e6u0m21 | 2:464-706 |
| P29469 | DB00171 | ATP | 6u0m | e6u0m22 | 2:737-864 |
| P29469 | DB00171 | ATP | 7p30 | e7p3022 | 2:461-709 |
| P29469 | DB00171 | ATP | 7p30 | e7p30A5 | A:461-709 |
| P29469 | DB00171 | ATP | 7p5z | e7p5z24 | 2:461-709 |
| P29469 | DB00171 | ATP | 7p5z | e7p5zA2 | A:461-709 |