Attributes
UniProt ID
Protein Name
Minichromosome maintenance protein 5
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JA8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ja821e3ja822e3ja823e3ja824e3ja825e3ja831e3ja832e3ja833e3ja834e3ja835e3ja842e3ja843e3ja844e3ja845e3ja846e3ja851e3ja852e3ja854e3ja855e3ja856e3ja861e3ja862e3ja863e3ja864e3ja865e3ja872e3ja873e3ja874e3ja875e3ja876
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29496 | DB16833 | ADP | 3ja8 | e3ja855 | 5:336-572 |
| P29496 | DB16833 | ADP | 3ja8 | e3ja856 | 5:573-693 |
| P29496 | DB16833 | ADP | 6eyc | e6eyc51 | 5:573-693 |
| P29496 | DB16833 | ADP | 6eyc | e6eyc52 | 5:336-572 |
| P29496 | DB16833 | ADP | 6f0l | e6f0l52 | 5:336-572 |
| P29496 | DB16833 | ADP | 6f0l | e6f0l55 | 5:573-693 |
| P29496 | DB16833 | ADP | 6f0l | e6f0lD3 | D:573-693 |
| P29496 | DB16833 | ADP | 6f0l | e6f0lD4 | D:336-572 |
| P29496 | DB16833 | ADP | 6rqc | e6rqc51 | 5:573-693 |
| P29496 | DB16833 | ADP | 6rqc | e6rqc54 | 5:336-572 |
| P29496 | DB16833 | ADP | 7pt6 | e7pt653 | 5:573-700 |
| P29496 | DB16833 | ADP | 7pt6 | e7pt655 | 5:336-572 |
| P29496 | DB16833 | ADP | 7pt6 | e7pt6E2 | E:573-700 |
| P29496 | DB16833 | ADP | 7pt6 | e7pt6E4 | E:336-572 |
| P29496 | DB16833 | ADP | 7pt7 | e7pt752 | 5:336-572 |
| P29496 | DB16833 | ADP | 7pt7 | e7pt755 | 5:573-696 |
| P29496 | DB16833 | ADP | 7pt7 | e7pt7E3 | E:573-696 |
| P29496 | DB16833 | ADP | 7pt7 | e7pt7E4 | E:336-572 |
| P29496 | DB16833 | ADP | 7v3v | e7v3v52 | 5:336-572 |
| P29496 | DB16833 | ADP | 7v3v | e7v3v53 | 5:573-625,5:645-701 |
| P29496 | DB16833 | ADP | 7v3v | e7v3vE1 | E:573-625,E:645-701 |
| P29496 | DB16833 | ADP | 7v3v | e7v3vE3 | E:336-572 |