Attributes
UniProt ID
Protein Name
Myrosinase MA1
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1DWA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1dwaM1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29736 | DB00141 | NAG | 1dwa | e1dwaM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1dwf | e1dwfM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1dwg | e1dwgM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1dwh | e1dwhM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1dwi | e1dwiM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1dwj | e1dwjM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e4m | e1e4mM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e6q | e1e6qM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e6s | e1e6sM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e6x | e1e6xM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e70 | e1e70M1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e71 | e1e71M1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e72 | e1e72M1 | M:3-501 |
| P29736 | DB00141 | NAG | 1e73 | e1e73M1 | M:3-501 |
| P29736 | DB00141 | NAG | 1myr | e1myrA1 | A:3-501 |
| P29736 | DB00141 | NAG | 1w9b | e1w9bM1 | M:3-501 |
| P29736 | DB00141 | NAG | 1w9d | e1w9dM1 | M:3-501 |
| P29736 | DB00141 | NAG | 2wxd | e2wxdM1 | M:3-501 |