Attributes
UniProt ID
Protein Name
Cysteine synthase B -lyase B
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2JC3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2jc3A1e2jc3A2e2jc3B1e2jc3B2e2jc3C1e2jc3C2e2jc3D1e2jc3D2e2jc3E1e2jc3E2e2jc3F1e2jc3F2e2jc3G1e2jc3G2e2jc3H1e2jc3H2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P29848 | DB00114 | PLP | 2jc3 | e2jc3A1 | A:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3A2 | A:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3B1 | B:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3B2 | B:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3C1 | C:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3C2 | C:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3D1 | D:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3D2 | D:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3E1 | E:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3E2 | E:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3F1 | F:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3F2 | F:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3G1 | G:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3G2 | G:1-146 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3H1 | H:147-294 |
| P29848 | DB00114 | PLP | 2jc3 | e2jc3H2 | H:1-146 |