Attributes
UniProt ID
Protein Name
Pyruvate kinase PKLR
Ligand Name
(1M)-6-[4-(3-aminobenzene-1-sulfonyl)piperazine-1-sulfonyl][1,1'-biphenyl]-3,3',4,4'-tetrol
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RKRYYZNPSXXWRX-UHFFFAOYSA-N
SMILES
c1cc(cc(c1)S(=O)(=O)N2CCN(CC2)S(=O)(=O)c3cc(c(cc3c4ccc(c(c4)O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7FSA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7fsaA1e7fsaA2e7fsaB1e7fsaB2e7fsaC1e7fsaC2e7fsaD1e7fsaD2e7fsaE1e7fsaE2e7fsaF1e7fsaF2e7fsaG1e7fsaG2e7fsaH1e7fsaH2
ECOD domains from experimental PDB structures interacting with ligand OCU
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P30613 | n/a | OCU | 7fsa | e7fsaA1 | A:23-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaA2 | A:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaB1 | B:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaB2 | B:10-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaC1 | C:19-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaC2 | C:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaD1 | D:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaD2 | D:21-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaE1 | E:23-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaE2 | E:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaF1 | F:11-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaF2 | F:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaG1 | G:23-408 |
| P30613 | n/a | OCU | 7fsa | e7fsaG2 | G:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaH1 | H:409-543 |
| P30613 | n/a | OCU | 7fsa | e7fsaH2 | H:21-408 |