Attributes
UniProt ID
Protein Name
Tyrosine phenol-lyase
Ligand Name
2-{[(E)-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene]amino}prop-2-enoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BHIGINKEEFZJGX-YIXHJXPBSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(=C)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6MLS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6mlsA1e6mlsA2e6mlsB1e6mlsB2
ECOD domains from experimental PDB structures interacting with ligand 0JO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31013 | n/a | 0JO | 6mls | e6mlsA1 | A:2-311 |
| P31013 | n/a | 0JO | 6mls | e6mlsA2 | A:312-456 |
| P31013 | n/a | 0JO | 6mls | e6mlsB2 | B:2-311 |
| P31013 | n/a | 0JO | 6mme | e6mmeA1 | A:2-311 |
| P31013 | n/a | 0JO | 6mme | e6mmeA2 | A:312-456 |
| P31013 | n/a | 0JO | 6mme | e6mmeB1 | B:312-456 |
| P31013 | n/a | 0JO | 6mme | e6mmeB2 | B:2-311 |
| P31013 | n/a | 0JO | 6mo3 | e6mo3A1 | A:2-311 |
| P31013 | n/a | 0JO | 6mo3 | e6mo3A2 | A:312-456 |
| P31013 | n/a | 0JO | 6mo3 | e6mo3B2 | B:2-311 |
| P31013 | n/a | 0JO | 6mpd | e6mpdA1 | A:2-311 |
| P31013 | n/a | 0JO | 6mpd | e6mpdA2 | A:312-456 |
| P31013 | n/a | 0JO | 6mpd | e6mpdB1 | B:2-311 |
| P31013 | n/a | 0JO | 6mqq | e6mqqA1 | A:312-456 |
| P31013 | n/a | 0JO | 6mqq | e6mqqA2 | A:2-311 |
| P31013 | n/a | 0JO | 6mqq | e6mqqB1 | B:312-456 |
| P31013 | n/a | 0JO | 6mqq | e6mqqB2 | B:2-311 |
| P31013 | n/a | 0JO | 6nv8 | e6nv8A1 | A:312-456 |
| P31013 | n/a | 0JO | 6nv8 | e6nv8A2 | A:2-311 |
| P31013 | n/a | 0JO | 6nv8 | e6nv8B1 | B:2-311 |