Attributes
UniProt ID
Protein Name
S-adenosylmethionine synthase isoform type-2
Ligand Name
5'-DEOXY-5'-METHYLTHIOADENOSINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WUUGFSXJNOTRMR-IOSLPCCCSA-N
SMILES
CSCC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7L1A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7l1aA1e7l1aA2e7l1aA3
ECOD domains from experimental PDB structures interacting with ligand DB02282
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31153 | DB02282 | MTA | 7l1a | e7l1aA1 | A:16-125 |
| P31153 | DB02282 | MTA | 7l1a | e7l1aA2 | A:252-395 |
| P31153 | DB02282 | MTA | 7l1a | e7l1aA3 | A:126-251 |
| P31153 | DB02282 | MTA | 7rxv | e7rxvA1 | A:252-395 |
| P31153 | DB02282 | MTA | 7rxv | e7rxvA2 | A:125-251 |
| P31153 | DB02282 | MTA | 7rxv | e7rxvA3 | A:16-124 |
| P31153 | DB02282 | MTA | 7rxw | e7rxwA1 | A:252-395 |
| P31153 | DB02282 | MTA | 7rxw | e7rxwA2 | A:125-251 |
| P31153 | DB02282 | MTA | 7rxw | e7rxwA3 | A:15-124 |
| P31153 | DB02282 | MTA | 7rxx | e7rxxA1 | A:252-395 |
| P31153 | DB02282 | MTA | 7rxx | e7rxxA2 | A:125-251 |
| P31153 | DB02282 | MTA | 7rxx | e7rxxA3 | A:16-124 |
| P31153 | DB02282 | MTA | 8p1w | e8p1wAAA1 | AAA:15-125 |
| P31153 | DB02282 | MTA | 8p1w | e8p1wAAA2 | AAA:252-395 |
| P31153 | DB02282 | MTA | 8p1w | e8p1wAAA3 | AAA:126-251 |