Attributes
UniProt ID
Protein Name
Multidrug efflux pump subunit AcrB
Ligand Name
CITRATE ANION
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-K
SMILES
C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2GIF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2gifA1e2gifA2e2gifA3e2gifA4e2gifA5e2gifA6e2gifA7e2gifA8e2gifB1e2gifB2e2gifB3e2gifB4e2gifB5e2gifB6e2gifB7e2gifB8e2gifC1e2gifC2e2gifC3e2gifC4e2gifC5e2gifC6e2gifC7e2gifC8
ECOD domains from experimental PDB structures interacting with ligand FLC
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31224 | n/a | FLC | 2gif | e2gifA4 | A:37-134 |
| P31224 | n/a | FLC | 2gif | e2gifA5 | A:725-812 |
| P31224 | n/a | FLC | 2gif | e2gifA7 | A:674-724,A:810-868 |
| P31224 | n/a | FLC | 2gif | e2gifB1 | B:674-724,B:813-868 |
| P31224 | n/a | FLC | 2gif | e2gifB7 | B:38-134 |
| P31224 | n/a | FLC | 2gif | e2gifC8 | C:725-812 |
| P31224 | n/a | FLC | 2hrt | e2hrtA3 | A:37-134 |
| P31224 | n/a | FLC | 2hrt | e2hrtA6 | A:674-724,A:810-868 |
| P31224 | n/a | FLC | 2hrt | e2hrtA8 | A:725-812 |
| P31224 | n/a | FLC | 2hrt | e2hrtB12 | B:38-134 |
| P31224 | n/a | FLC | 2hrt | e2hrtB14 | B:660-709,B:798-844 |
| P31224 | n/a | FLC | 2hrt | e2hrtC8 | C:725-812 |
| P31224 | n/a | FLC | 2hrt | e2hrtD3 | D:37-134 |
| P31224 | n/a | FLC | 2hrt | e2hrtD6 | D:674-724,D:810-868 |
| P31224 | n/a | FLC | 2hrt | e2hrtD8 | D:725-812 |
| P31224 | n/a | FLC | 2hrt | e2hrtE3 | E:37-134 |
| P31224 | n/a | FLC | 2hrt | e2hrtE6 | E:674-724,E:810-868 |
| P31224 | n/a | FLC | 2hrt | e2hrtE8 | E:725-812 |
| P31224 | n/a | FLC | 2hrt | e2hrtF8 | F:725-812 |