Attributes
UniProt ID
Protein Name
ATPase RavA
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3NBX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3nbxX1e3nbxX2e3nbxX3e3nbxX4
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31473 | DB16833 | ADP | 3nbx | e3nbxX1 | X:3-220 |
| P31473 | DB16833 | ADP | 6q7l | e6q7lU3 | U:3-220 |
| P31473 | DB16833 | ADP | 6q7l | e6q7lU4 | U:221-305 |
| P31473 | DB16833 | ADP | 6sza | e6szaA4 | A:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaB1 | B:221-305 |
| P31473 | DB16833 | ADP | 6sza | e6szaB4 | B:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaC2 | C:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaC3 | C:221-305 |
| P31473 | DB16833 | ADP | 6sza | e6szaD3 | D:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaE2 | E:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaE3 | E:221-305 |
| P31473 | DB16833 | ADP | 6sza | e6szaF1 | F:3-220 |
| P31473 | DB16833 | ADP | 6sza | e6szaF2 | F:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbA2 | A:3-220 |
| P31473 | DB16833 | ADP | 6szb | e6szbB1 | B:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbB2 | B:3-220 |
| P31473 | DB16833 | ADP | 6szb | e6szbC2 | C:3-220 |
| P31473 | DB16833 | ADP | 6szb | e6szbC4 | C:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbD2 | D:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbD4 | D:3-220 |
| P31473 | DB16833 | ADP | 6szb | e6szbE1 | E:3-220 |
| P31473 | DB16833 | ADP | 6szb | e6szbE3 | E:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbF1 | F:221-305 |
| P31473 | DB16833 | ADP | 6szb | e6szbF2 | F:3-220 |