Attributes
UniProt ID
Protein Name
Sodium-dependent serotonin transporter
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5I6X
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5i6xA1e5i6xB1e5i6xB2e5i6xC1e5i6xC2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31645 | DB00141 | NAG | 5i6x | e5i6xA1 | A:74-617 |
| P31645 | DB00141 | NAG | 5i6z | e5i6zA1 | A:74-617 |
| P31645 | DB00141 | NAG | 5i71 | e5i71A1 | A:74-615 |
| P31645 | DB00141 | NAG | 5i73 | e5i73A1 | A:77-616 |
| P31645 | DB00141 | NAG | 5i74 | e5i74A1 | A:74-615 |
| P31645 | DB00141 | NAG | 5i75 | e5i75A1 | A:77-616 |
| P31645 | DB00141 | NAG | 6awn | e6awnA1 | A:74-617 |
| P31645 | DB00141 | NAG | 6awo | e6awoA1 | A:74-617 |
| P31645 | DB00141 | NAG | 6awp | e6awpA1 | A:74-617 |
| P31645 | DB00141 | NAG | 6awq | e6awqA1 | A:74-617 |
| P31645 | DB00141 | NAG | 6dzw | e6dzwA1 | A:79-615 |
| P31645 | DB00141 | NAG | 6vrh | e6vrhA1 | A:77-617 |
| P31645 | DB00141 | NAG | 6vrk | e6vrkA1 | A:77-617 |
| P31645 | DB00141 | NAG | 6vrl | e6vrlA1 | A:77-617 |
| P31645 | DB00141 | NAG | 6w2b | e6w2bA1 | A:74-617 |
| P31645 | DB00141 | NAG | 7lwd | e7lwdA1 | A:77-617 |