Attributes
UniProt ID
Protein Name
Trehalose-6-phosphate synthase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GZ5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gz5A1e1gz5A2e1gz5B1e1gz5B2e1gz5C1e1gz5C2e1gz5D1e1gz5D2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31677 | DB03435 | UDP | 1gz5 | e1gz5A1 | A:225-456 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5A2 | A:1-224 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5B1 | B:1-224 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5B2 | B:225-456 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5C1 | C:225-456 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5C2 | C:1-224 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5D1 | D:1-224 |
| P31677 | DB03435 | UDP | 1gz5 | e1gz5D2 | D:225-456 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxA1 | A:1-224 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxA2 | A:225-456 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxB1 | B:1-224 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxB2 | B:225-458 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxC1 | C:1-224 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxC2 | C:225-456 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxD1 | D:1-224 |
| P31677 | DB03435 | UDP | 2wtx | e2wtxD2 | D:225-457 |