Attributes
UniProt ID
Protein Name
14-3-3 protein sigma
Ligand Name
2-[3-(2-HYDROXY-1,1-DIHYDROXYMETHYL-ETHYLAMINO)-PROPYLAMINO]-2-HYDROXYMETHYL-PROPANE-1,3-DIOL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HHKZCCWKTZRCCL-UHFFFAOYSA-N
SMILES
C(CNC(CO)(CO)CO)CNC(CO)(CO)CO
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6QZR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6qzrA1e6qzrB1e6qzrC1e6qzrD1e6qzrE1e6qzrF1e6qzrG1e6qzrH1
ECOD domains from experimental PDB structures interacting with ligand DB02676
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P31947 | DB02676 | B3P | 6qzr | e6qzrA1 | A:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrB1 | B:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrC1 | C:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrD1 | D:-4-229 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrE1 | E:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrF1 | F:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrG1 | G:-4-231 |
| P31947 | DB02676 | B3P | 6qzr | e6qzrH1 | H:-4-231 |
| P31947 | DB02676 | B3P | 6qzs | e6qzsA1 | A:-4-231 |
| P31947 | DB02676 | B3P | 6qzs | e6qzsB1 | B:-4-231 |
| P31947 | DB02676 | B3P | 6twz | e6twzD1 | D:-2-231 |
| P31947 | DB02676 | B3P | 6yr6 | e6yr6A1 | A:-4-231 |
| P31947 | DB02676 | B3P | 6yr6 | e6yr6C1 | C:-4-231 |
| P31947 | DB02676 | B3P | 6yr6 | e6yr6E1 | E:-4-231 |
| P31947 | DB02676 | B3P | 6yr6 | e6yr6G1 | G:-4-231 |
| P31947 | DB02676 | B3P | 6yr7 | e6yr7A1 | A:-3-231 |