Attributes
UniProt ID
Protein Name
Pyrroline-5-carboxylate reductase 1, mitochondrial
Ligand Name
1,4-DIHYDRONICOTINAMIDE ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BOPGDPNILDQYTO-NNYOXOHSSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)N5C=CCC(=C5)C(=O)N)O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2GR9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2gr9A1e2gr9A2e2gr9B1e2gr9B2e2gr9C1e2gr9C2e2gr9D1e2gr9D2e2gr9E1e2gr9E2
ECOD domains from experimental PDB structures interacting with ligand DB00157
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P32322 | DB00157 | NAI | 2gr9 | e2gr9A1 | A:163-275 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9A2 | A:-1-162 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9B1 | B:163-275 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9B2 | B:-1-162 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9C1 | C:163-275 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9C2 | C:-1-162 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9D1 | D:163-275 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9D2 | D:-1-162 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9E1 | E:163-275 |
| P32322 | DB00157 | NAI | 2gr9 | e2gr9E2 | E:-1-162 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgA1 | A:-2-162 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgA2 | A:163-273 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgB1 | B:-5-162 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgB2 | B:163-274 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgC1 | C:-3-162 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgC2 | C:163-274 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgD1 | D:-6-162 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgD2 | D:163-273 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgE1 | E:163-273 |
| P32322 | DB00157 | NAI | 8dkg | e8dkgE2 | E:-1-162 |