Attributes
UniProt ID
Protein Name
Elongation factor 2
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1U2R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1u2rA1e1u2rA2e1u2rA3e1u2rA4e1u2rA5
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P32324 | DB04315 | GDP | 1u2r | e1u2rA5 | A:3-343 |
| P32324 | DB04315 | GDP | 2e1r | e2e1rA5 | A:3-343 |
| P32324 | DB04315 | GDP | 2npf | e2npfA5 | A:3-343 |
| P32324 | DB04315 | GDP | 2npf | e2npfB5 | B:3-343 |
| P32324 | DB04315 | GDP | 2p8y | e2p8yT5 | T:3-343 |
| P32324 | DB04315 | GDP | 5juo | e5juoDC3 | DC:2-343 |
| P32324 | DB04315 | GDP | 5jup | e5jupDC4 | DC:2-343 |
| P32324 | DB04315 | GDP | 5jus | e5jusDC1 | DC:2-343 |
| P32324 | DB04315 | GDP | 5jut | e5jutDC1 | DC:2-343 |
| P32324 | DB04315 | GDP | 5juu | e5juuDC2 | DC:2-343 |
| P32324 | DB04315 | GDP | 6gqb | e6gqbAZ2 | AZ:3-343 |
| P32324 | DB04315 | GDP | 8eub | e8eubDC3 | DC:2-343 |
| P32324 | DB04315 | GDP | 8evq | e8evqDC1 | DC:2-343 |
| P32324 | DB04315 | GDP | 8evr | e8evrDC2 | DC:2-343 |
| P32324 | DB04315 | GDP | 8evs | e8evsDC1 | DC:2-343 |
| P32324 | DB04315 | GDP | 8ewb | e8ewbDC4 | DC:2-343 |