Attributes
UniProt ID
Protein Name
26S proteasome regulatory subunit 6B homolog
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5MP9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5mp911e5mp921e5mp931e5mp941e5mp951e5mp961e5mp971e5mp9A1e5mp9B1e5mp9C1e5mp9D1e5mp9E1e5mp9F1e5mp9G1e5mp9H3e5mp9I1e5mp9I2e5mp9I3e5mp9K1e5mp9K2e5mp9K3e5mp9L1e5mp9L2e5mp9L3e5mp9M1e5mp9M2e5mp9M3e5mp9a1e5mp9b1e5mp9c1e5mp9d1e5mp9e1e5mp9f1e5mp9g1e5mp9h1e5mp9i1e5mp9j1e5mp9k1e5mp9l1e5mp9m1e5mp9n1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P33298 | DB00171 | ATP | 5mp9 | e5mp9K1 | K:341-428 |
| P33298 | DB00171 | ATP | 5mp9 | e5mp9K3 | K:153-340 |
| P33298 | DB00171 | ATP | 6ef0 | e6ef0K1 | K:157-337 |
| P33298 | DB00171 | ATP | 6ef0 | e6ef0K2 | K:338-428 |
| P33298 | DB00171 | ATP | 6ef1 | e6ef1K1 | K:338-428 |
| P33298 | DB00171 | ATP | 6ef1 | e6ef1K2 | K:153-337 |
| P33298 | DB00171 | ATP | 6ef2 | e6ef2K1 | K:170-337 |
| P33298 | DB00171 | ATP | 6ef3 | e6ef3K3 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvt | e6fvtK2 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvt | e6fvtK3 | K:341-428 |
| P33298 | DB00171 | ATP | 6fvu | e6fvuK1 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvu | e6fvuK3 | K:341-428 |
| P33298 | DB00171 | ATP | 6fvv | e6fvvK1 | K:341-428 |
| P33298 | DB00171 | ATP | 6fvv | e6fvvK2 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvw | e6fvwK2 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvx | e6fvxK1 | K:341-428 |
| P33298 | DB00171 | ATP | 6fvx | e6fvxK2 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvy | e6fvyK1 | K:153-340 |
| P33298 | DB00171 | ATP | 6fvy | e6fvyK3 | K:341-428 |
| P33298 | DB00171 | ATP | 7qo5 | e7qo5K1 | K:341-428 |
| P33298 | DB00171 | ATP | 7qo5 | e7qo5K3 | K:153-340 |