Attributes
UniProt ID
Protein Name
Pre-mRNA-splicing factor 8
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JCM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3jcmA1e3jcmA2e3jcmA3e3jcmA4e3jcmA5e3jcmA6e3jcmB3e3jcmG1e3jcmH1e3jcmH2e3jcmH3e3jcmH4e3jcmH5e3jcmI1e3jcmI2e3jcmI3e3jcmJ1e3jcmK1e3jcmK2e3jcmL1e3jcmM1e3jcmN1e3jcmN10e3jcmN11e3jcmN12e3jcmN2e3jcmN3e3jcmN4e3jcmN5e3jcmN6e3jcmN7e3jcmN8e3jcmN9e3jcmO1e3jcmP1e3jcmQ1e3jcmR1e3jcmS1e3jcmT1e3jcmU1e3jcmV1e3jcmW1e3jcmX1e3jcmY1e3jcmZ1e3jcma1e3jcmb1e3jcmc1e3jcmd1e3jcme1e3jcmf1e3jcmg1e3jcmh1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P33334 | DB04137 | GTP | 3jcm | e3jcmA1 | A:130-883 |
| P33334 | DB04137 | GTP | 5gam | e5gamA1 | A:110-428,A:458-735 |
| P33334 | DB04137 | GTP | 5gan | e5ganA1 | A:110-883 |
| P33334 | DB04137 | GTP | 5gm6 | e5gm6A3 | A:127-431,A:451-883 |
| P33334 | DB04137 | GTP | 5gmk | e5gmkA1 | A:127-884 |
| P33334 | DB04137 | GTP | 5lj3 | e5lj3A1 | A:128-428,A:456-883 |
| P33334 | DB04137 | GTP | 5lj5 | e5lj5A6 | A:128-428,A:456-883 |
| P33334 | DB04137 | GTP | 5mps | e5mpsA1 | A:127-428,A:456-883 |
| P33334 | DB04137 | GTP | 5mq0 | e5mq0A1 | A:127-428,A:456-883 |
| P33334 | DB04137 | GTP | 5nrl | e5nrlA6 | A:128-883 |
| P33334 | DB04137 | GTP | 5wsg | e5wsgA1 | A:127-884 |
| P33334 | DB04137 | GTP | 5y88 | e5y88A4 | A:127-884 |
| P33334 | DB04137 | GTP | 5ylz | e5ylzA1 | A:127-884 |
| P33334 | DB04137 | GTP | 5zwm | e5zwmA6 | A:131-883 |
| P33334 | DB04137 | GTP | 5zwo | e5zwoA4 | A:131-431,A:455-883 |
| P33334 | DB04137 | GTP | 6bk8 | e6bk8A1 | A:126-884 |
| P33334 | DB04137 | GTP | 6exn | e6exnA4 | A:126-884 |
| P33334 | DB04137 | GTP | 6j6g | e6j6gA5 | A:127-884 |
| P33334 | DB04137 | GTP | 6j6h | e6j6hA2 | A:127-884 |
| P33334 | DB04137 | GTP | 6j6n | e6j6nA2 | A:127-884 |
| P33334 | DB04137 | GTP | 6j6q | e6j6qA5 | A:127-884 |
| P33334 | DB04137 | GTP | 7b9v | e7b9vA3 | A:126-883 |