Attributes
UniProt ID
Protein Name
Pre-mRNA-splicing factor 8
Ligand Name
INOSITOL HEXAKISPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IMQLKJBTEOYOSI-GPIVLXJGSA-N
SMILES
C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5MPS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5mpsA1e5mpsA2e5mpsA3e5mpsA4e5mpsA5e5mpsC1e5mpsC2e5mpsC3e5mpsC4e5mpsC5e5mpsC6e5mpsH1e5mpsH2e5mpsJ1e5mpsL1e5mpsM1e5mpsM2e5mpsN1e5mpsN2e5mpsR1e5mpsS1e5mpsT1e5mpsa1e5mpsb1e5mpsd1e5mpse1e5mpsf1e5mpsg1e5mpsh1e5mpsj1e5mpso1
ECOD domains from experimental PDB structures interacting with ligand DB14981
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P33334 | DB14981 | IHP | 5mps | e5mpsA1 | A:127-428,A:456-883 |
| P33334 | DB14981 | IHP | 5mps | e5mpsA5 | A:1600-1828 |
| P33334 | DB14981 | IHP | 5mq0 | e5mq0A1 | A:127-428,A:456-883 |
| P33334 | DB14981 | IHP | 5mq0 | e5mq0A5 | A:1600-1828 |
| P33334 | DB14981 | IHP | 5y88 | e5y88A1 | A:1575-1576,A:1603-1828 |
| P33334 | DB14981 | IHP | 5y88 | e5y88A4 | A:127-884 |
| P33334 | DB14981 | IHP | 5ylz | e5ylzA1 | A:127-884 |
| P33334 | DB14981 | IHP | 5ylz | e5ylzA2 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6bk8 | e6bk8A1 | A:126-884 |
| P33334 | DB14981 | IHP | 6bk8 | e6bk8A3 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6exn | e6exnA3 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6exn | e6exnA4 | A:126-884 |
| P33334 | DB14981 | IHP | 6j6g | e6j6gA2 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6j6g | e6j6gA5 | A:127-884 |
| P33334 | DB14981 | IHP | 6j6h | e6j6hA2 | A:127-884 |
| P33334 | DB14981 | IHP | 6j6h | e6j6hA3 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6j6n | e6j6nA1 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6j6n | e6j6nA2 | A:127-884 |
| P33334 | DB14981 | IHP | 6j6n | e6j6nA3 | A:1256-1574 |
| P33334 | DB14981 | IHP | 6j6q | e6j6qA2 | A:1575-1577,A:1599-1828 |
| P33334 | DB14981 | IHP | 6j6q | e6j6qA5 | A:127-884 |