Attributes
UniProt ID
Protein Name
ATP-binding cassette sub-family D member 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7SHM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7shmA1e7shmA2e7shmB1e7shmB2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P33897 | DB00171 | ATP | 7shm | e7shmA1 | A:463-683 |
| P33897 | DB00171 | ATP | 7shm | e7shmB1 | B:462-683 |
| P33897 | DB00171 | ATP | 7x0t | e7x0tB1 | B:67-436 |
| P33897 | DB00171 | ATP | 7x0t | e7x0tB2 | B:460-722 |
| P33897 | DB00171 | ATP | 7x0z | e7x0zA1 | A:64-351,A:379-437 |
| P33897 | DB00171 | ATP | 7x0z | e7x0zA2 | A:457-685 |
| P33897 | DB00171 | ATP | 7x0z | e7x0zB1 | B:64-354,B:378-437 |
| P33897 | DB00171 | ATP | 7x0z | e7x0zB2 | B:457-685 |
| P33897 | DB00171 | ATP | 7x1w | e7x1wA1 | A:64-437 |
| P33897 | DB00171 | ATP | 7x1w | e7x1wA2 | A:461-682 |
| P33897 | DB00171 | ATP | 7x1w | e7x1wB1 | B:64-437 |
| P33897 | DB00171 | ATP | 7x1w | e7x1wB2 | B:461-682 |
| P33897 | DB00171 | ATP | 7xec | e7xecA1 | A:65-439 |
| P33897 | DB00171 | ATP | 7xec | e7xecA2 | A:461-682 |