Attributes
UniProt ID
Protein Name
Nitric oxide synthase, inducible
Ligand Name
5,6,7,8-TETRAHYDROBIOPTERIN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FNKQXYHWGSIFBK-RPDRRWSUSA-N
SMILES
CC(C(C1CNC2=C(N1)C(=O)NC(=N2)N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NSI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1nsiA1e1nsiB1e1nsiC1e1nsiD1
ECOD domains from experimental PDB structures interacting with ligand DB00360
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P35228 | DB00360 | H4B | 1nsi | e1nsiA1 | A:83-496 |
| P35228 | DB00360 | H4B | 1nsi | e1nsiB1 | B:83-496 |
| P35228 | DB00360 | H4B | 1nsi | e1nsiC1 | C:83-496 |
| P35228 | DB00360 | H4B | 1nsi | e1nsiD1 | D:83-496 |
| P35228 | DB00360 | H4B | 2nsi | e2nsiA1 | A:83-496 |
| P35228 | DB00360 | H4B | 2nsi | e2nsiB1 | B:83-496 |
| P35228 | DB00360 | H4B | 2nsi | e2nsiC1 | C:83-496 |
| P35228 | DB00360 | H4B | 2nsi | e2nsiD1 | D:83-496 |
| P35228 | DB00360 | H4B | 3e7g | e3e7gA1 | A:83-496 |
| P35228 | DB00360 | H4B | 3e7g | e3e7gB1 | B:83-496 |
| P35228 | DB00360 | H4B | 3e7g | e3e7gC1 | C:83-496 |
| P35228 | DB00360 | H4B | 3e7g | e3e7gD1 | D:83-496 |
| P35228 | DB00360 | H4B | 3ej8 | e3ej8A1 | A:83-503 |
| P35228 | DB00360 | H4B | 3ej8 | e3ej8B1 | B:83-503 |
| P35228 | DB00360 | H4B | 3ej8 | e3ej8C1 | C:83-503 |
| P35228 | DB00360 | H4B | 3ej8 | e3ej8D1 | D:83-503 |
| P35228 | DB00360 | H4B | 4cx7 | e4cx7A1 | A:83-503 |
| P35228 | DB00360 | H4B | 4cx7 | e4cx7B1 | B:83-503 |
| P35228 | DB00360 | H4B | 4cx7 | e4cx7C1 | C:83-503 |
| P35228 | DB00360 | H4B | 4cx7 | e4cx7D1 | D:83-503 |
| P35228 | DB00360 | H4B | 4nos | e4nosA1 | A:83-496 |
| P35228 | DB00360 | H4B | 4nos | e4nosB1 | B:83-496 |
| P35228 | DB00360 | H4B | 4nos | e4nosC1 | C:83-496 |
| P35228 | DB00360 | H4B | 4nos | e4nosD1 | D:83-496 |