Attributes
UniProt ID
Protein Name
Prostaglandin G/H synthase 2
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5F19
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5f19A1e5f19A2e5f19B1e5f19B2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P35354 | DB00141 | NAG | 5f19 | e5f19A2 | A:74-583 |
| P35354 | DB00141 | NAG | 5f19 | e5f19B1 | B:74-583 |
| P35354 | DB00141 | NAG | 5f19 | e5f19B2 | B:33-73 |
| P35354 | DB00141 | NAG | 5f1a | e5f1aA1 | A:74-584 |
| P35354 | DB00141 | NAG | 5f1a | e5f1aB2 | B:74-583 |
| P35354 | DB00141 | NAG | 5ikq | e5ikqA1 | A:74-583 |
| P35354 | DB00141 | NAG | 5ikq | e5ikqB2 | B:74-584 |
| P35354 | DB00141 | NAG | 5ikr | e5ikrA1 | A:74-583 |
| P35354 | DB00141 | NAG | 5ikr | e5ikrB2 | B:74-583 |
| P35354 | DB00141 | NAG | 5ikt | e5iktA1 | A:74-583 |
| P35354 | DB00141 | NAG | 5ikt | e5iktB1 | B:74-583 |
| P35354 | DB00141 | NAG | 5ikt | e5iktB2 | B:34-73 |
| P35354 | DB00141 | NAG | 5ikv | e5ikvA1 | A:74-583 |
| P35354 | DB00141 | NAG | 5ikv | e5ikvB2 | B:74-583 |
| P35354 | DB00141 | NAG | 5kir | e5kirA1 | A:74-583 |
| P35354 | DB00141 | NAG | 5kir | e5kirB2 | B:74-583 |