Attributes
UniProt ID
Protein Name
Thioredoxin-dependent peroxide reductase, mitochondrial
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4MH2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4mh2A1e4mh2B1e4mh2C1e4mh2D1e4mh2E1e4mh2F1e4mh2G1e4mh2H1e4mh2I1e4mh2J1e4mh2K1e4mh2L1
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P35705 | DB04272 | CIT | 4mh2 | e4mh2A1 | A:1-165 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2B1 | B:0-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2C1 | C:2-165 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2D1 | D:0-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2E1 | E:2-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2F1 | F:0-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2G1 | G:1-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2H1 | H:2-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2I1 | I:-1-163 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2J1 | J:1-163 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2K1 | K:1-164 |
| P35705 | DB04272 | CIT | 4mh2 | e4mh2L1 | L:1-165 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3A1 | A:1-166 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3B1 | B:2-169 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3C1 | C:2-170 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3D1 | D:2-169 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3G1 | G:0-167 |
| P35705 | DB04272 | CIT | 4mh3 | e4mh3H1 | H:2-168 |