Attributes
UniProt ID
Protein Name
Neuronal acetylcholine receptor subunit alpha-7
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7EKI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ekiA1e7ekiA2e7ekiB1e7ekiB2e7ekiC1e7ekiC2e7ekiD1e7ekiD2e7ekiE1e7ekiE2
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P36544 | DB04540 | CLR | 7eki | e7ekiA1 | A:229-346,A:432-502 |
| P36544 | DB04540 | CLR | 7eki | e7ekiB2 | B:229-346,B:432-502 |
| P36544 | DB04540 | CLR | 7eki | e7ekiC2 | C:229-346,C:432-502 |
| P36544 | DB04540 | CLR | 7eki | e7ekiD1 | D:229-346,D:432-502 |
| P36544 | DB04540 | CLR | 7eki | e7ekiE2 | E:229-346,E:432-502 |
| P36544 | DB04540 | CLR | 7ekp | e7ekpA2 | A:229-347,A:434-502 |
| P36544 | DB04540 | CLR | 7ekp | e7ekpB2 | B:229-347,B:434-502 |
| P36544 | DB04540 | CLR | 7ekp | e7ekpC2 | C:229-347,C:434-502 |
| P36544 | DB04540 | CLR | 7ekp | e7ekpD1 | D:229-347,D:434-502 |
| P36544 | DB04540 | CLR | 7ekp | e7ekpE1 | E:229-347,E:434-502 |
| P36544 | DB04540 | CLR | 7ekt | e7ektA2 | A:229-347,A:434-502 |
| P36544 | DB04540 | CLR | 7ekt | e7ektB1 | B:229-347,B:434-502 |
| P36544 | DB04540 | CLR | 7ekt | e7ektC1 | C:229-347,C:434-502 |
| P36544 | DB04540 | CLR | 7ekt | e7ektD2 | D:229-347,D:434-502 |
| P36544 | DB04540 | CLR | 7ekt | e7ektE1 | E:229-347,E:434-502 |