Attributes
UniProt ID
Protein Name
Oxidized purine nucleoside triphosphate hydrolase
Ligand Name
[[(2R,3S,5R)-5-(6-azanyl-2-oxidanylidene-1H-purin-9-yl)-3-oxidanyl-oxolan-2-yl]methoxy-oxidanyl-phosphoryl] phosphono hydrogen phosphate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UOACBPRDWRDEHJ-KVQBGUIXSA-N
SMILES
C1C(C(OC1N2C=NC3=C(NC(=O)N=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5GHJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5ghjA1e5ghjB1
ECOD domains from experimental PDB structures interacting with ligand 6U4
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P36639 | n/a | 6U4 | 5ghj | e5ghjA1 | A:1-156 |
| P36639 | n/a | 6U4 | 5ghj | e5ghjB1 | B:1-156 |
| P36639 | n/a | 6U4 | 5ghn | e5ghnA1 | A:1-156 |
| P36639 | n/a | 6U4 | 5ghn | e5ghnB1 | B:1-156 |
| P36639 | n/a | 6U4 | 5ghq | e5ghqA1 | A:1-156 |
| P36639 | n/a | 6U4 | 5ghq | e5ghqB1 | B:1-156 |
| P36639 | n/a | 6U4 | 5ws7 | e5ws7A1 | A:1-156 |
| P36639 | n/a | 6U4 | 5ws7 | e5ws7B1 | B:1-156 |
| P36639 | n/a | 6U4 | 8i1d | e8i1dA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1d | e8i1dB1 | B:1-156 |
| P36639 | n/a | 6U4 | 8i1e | e8i1eA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1e | e8i1eB1 | B:1-156 |
| P36639 | n/a | 6U4 | 8i1f | e8i1fA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1f | e8i1fB1 | B:1-156 |
| P36639 | n/a | 6U4 | 8i1g | e8i1gA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1i | e8i1iA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1i | e8i1iB1 | B:1-156 |
| P36639 | n/a | 6U4 | 8i1j | e8i1jA1 | A:1-156 |
| P36639 | n/a | 6U4 | 8i1j | e8i1jB1 | B:1-156 |