Attributes
UniProt ID
Protein Name
Lon protease homolog, mitochondrial
Ligand Name
PHOSPHOTHIOPHOSPHORIC ACID-ADENYLATE ESTER
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NLTUCYMLOPLUHL-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7NFY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7nfyA1e7nfyA2e7nfyA3e7nfyA4e7nfyA5e7nfyB1e7nfyB2e7nfyB3e7nfyB4e7nfyB5e7nfyC1e7nfyC2e7nfyC3e7nfyC4e7nfyC5e7nfyD1e7nfyD2e7nfyD3e7nfyD4e7nfyD5e7nfyE1e7nfyE2e7nfyE3e7nfyE4e7nfyE5e7nfyF1e7nfyF2e7nfyF3e7nfyF4e7nfyF5
ECOD domains from experimental PDB structures interacting with ligand DB02930
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P36776 | DB02930 | AGS | 7nfy | e7nfyA1 | A:411-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyA4 | A:660-753 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyB1 | B:413-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyB4 | B:660-753 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyC1 | C:413-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyC4 | C:660-753 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyD1 | D:411-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyD4 | D:660-753 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyE1 | E:411-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyE4 | E:660-752 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyF1 | F:411-660 |
| P36776 | DB02930 | AGS | 7nfy | e7nfyF4 | F:660-753 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcA1 | A:411-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcA4 | A:660-753 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcB1 | B:410-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcB4 | B:659-753 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcC1 | C:410-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcC4 | C:659-753 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcD1 | D:410-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcE1 | E:410-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcE4 | E:659-753 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcF1 | F:410-660 |
| P36776 | DB02930 | AGS | 7ngc | e7ngcF4 | F:659-753 |