Attributes
UniProt ID
Protein Name
Pyruvate oxidase
Ligand Name
THIAMINE DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AYEKOFBPNLCAJY-UHFFFAOYSA-O
SMILES
Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1POW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1powA1e1powA2e1powA3e1powB1e1powB2e1powB3
ECOD domains from experimental PDB structures interacting with ligand TPP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P37063 | n/a | TPP | 1pow | e1powA2 | A:9-182 |
| P37063 | n/a | TPP | 1pow | e1powA3 | A:366-593 |
| P37063 | n/a | TPP | 1pow | e1powB2 | B:9-182 |
| P37063 | n/a | TPP | 1pow | e1powB3 | B:366-593 |
| P37063 | n/a | TPP | 1pox | e1poxA2 | A:9-182 |
| P37063 | n/a | TPP | 1pox | e1poxA3 | A:366-593 |
| P37063 | n/a | TPP | 1pox | e1poxB2 | B:9-182 |
| P37063 | n/a | TPP | 1pox | e1poxB3 | B:366-593 |
| P37063 | n/a | TPP | 1y9d | e1y9dA1 | A:366-593 |
| P37063 | n/a | TPP | 1y9d | e1y9dA2 | A:9-182 |
| P37063 | n/a | TPP | 1y9d | e1y9dB3 | B:9-182 |
| P37063 | n/a | TPP | 1y9d | e1y9dB4 | B:366-597 |
| P37063 | n/a | TPP | 1y9d | e1y9dC4 | C:366-593 |
| P37063 | n/a | TPP | 1y9d | e1y9dC5 | C:9-182 |
| P37063 | n/a | TPP | 1y9d | e1y9dD4 | D:366-593 |
| P37063 | n/a | TPP | 1y9d | e1y9dD5 | D:9-182 |
| P37063 | n/a | TPP | 2ez4 | e2ez4A2 | A:9-182 |
| P37063 | n/a | TPP | 2ez4 | e2ez4A3 | A:366-593 |
| P37063 | n/a | TPP | 2ez4 | e2ez4B2 | B:9-182 |
| P37063 | n/a | TPP | 2ez4 | e2ez4B3 | B:366-593 |