Attributes
UniProt ID
Protein Name
DNA replication licensing factor MCM7
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JA8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ja821e3ja822e3ja823e3ja824e3ja825e3ja831e3ja832e3ja833e3ja834e3ja835e3ja842e3ja843e3ja844e3ja845e3ja846e3ja851e3ja852e3ja854e3ja855e3ja856e3ja861e3ja862e3ja863e3ja864e3ja865e3ja872e3ja873e3ja874e3ja875e3ja876
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P38132 | DB16833 | ADP | 3ja8 | e3ja875 | 7:384-643 |
| P38132 | DB16833 | ADP | 3ja8 | e3ja876 | 7:644-729 |
| P38132 | DB16833 | ADP | 5bk4 | e5bk472 | 7:384-643 |
| P38132 | DB16833 | ADP | 5bk4 | e5bk4F2 | F:384-643 |
| P38132 | DB16833 | ADP | 6eyc | e6eyc71 | 7:644-729 |
| P38132 | DB16833 | ADP | 6eyc | e6eyc73 | 7:384-643 |
| P38132 | DB16833 | ADP | 6rqc | e6rqc72 | 7:384-643 |
| P38132 | DB16833 | ADP | 7p30 | e7p3073 | 7:384-643 |
| P38132 | DB16833 | ADP | 7p30 | e7p3074 | 7:644-729 |
| P38132 | DB16833 | ADP | 7p30 | e7p30F1 | F:384-643 |
| P38132 | DB16833 | ADP | 7p30 | e7p30F5 | F:644-729 |
| P38132 | DB16833 | ADP | 7p5z | e7p5z72 | 7:644-729 |
| P38132 | DB16833 | ADP | 7p5z | e7p5z74 | 7:384-643 |
| P38132 | DB16833 | ADP | 7p5z | e7p5zF3 | F:384-643 |
| P38132 | DB16833 | ADP | 7p5z | e7p5zF5 | F:644-729 |
| P38132 | DB16833 | ADP | 7pt6 | e7pt671 | 7:384-643 |
| P38132 | DB16833 | ADP | 7pt6 | e7pt6G3 | G:384-643 |
| P38132 | DB16833 | ADP | 7pt6 | e7pt6G5 | G:644-728 |
| P38132 | DB16833 | ADP | 7pt7 | e7pt774 | 7:644-728 |
| P38132 | DB16833 | ADP | 7pt7 | e7pt775 | 7:384-643 |
| P38132 | DB16833 | ADP | 7pt7 | e7pt7G1 | G:644-728 |
| P38132 | DB16833 | ADP | 7pt7 | e7pt7G4 | G:384-643 |
| P38132 | DB16833 | ADP | 7qhs | e7qhs71 | 7:384-643 |
| P38132 | DB16833 | ADP | 7qhs | e7qhs75 | 7:644-729 |