Attributes
UniProt ID
Protein Name
Flavohemoprotein
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1CQX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1cqxA1e1cqxA2e1cqxA3e1cqxB1e1cqxB2e1cqxB3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P39662 | DB03147 | FAD | 1cqx | e1cqxA1 | A:151-261 |
| P39662 | DB03147 | FAD | 1cqx | e1cqxA2 | A:1-150 |
| P39662 | DB03147 | FAD | 1cqx | e1cqxA3 | A:262-403 |
| P39662 | DB03147 | FAD | 1cqx | e1cqxB1 | B:151-261 |
| P39662 | DB03147 | FAD | 1cqx | e1cqxB2 | B:1-150 |
| P39662 | DB03147 | FAD | 1cqx | e1cqxB3 | B:262-403 |
| P39662 | DB03147 | FAD | 3ozu | e3ozuA1 | A:151-261 |
| P39662 | DB03147 | FAD | 3ozu | e3ozuA2 | A:1-150 |
| P39662 | DB03147 | FAD | 3ozu | e3ozuA3 | A:262-403 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvA1 | A:151-261 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvA2 | A:1-150 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvA3 | A:262-403 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvB1 | B:151-261 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvB2 | B:1-150 |
| P39662 | DB03147 | FAD | 3ozv | e3ozvB3 | B:262-403 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwA1 | A:151-261 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwA2 | A:1-150 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwA3 | A:262-403 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwB1 | B:151-261 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwB2 | B:1-150 |
| P39662 | DB03147 | FAD | 3ozw | e3ozwB3 | B:262-403 |