Attributes
UniProt ID
Protein Name
Calmodulin-sensitive adenylate cyclase
Ligand Name
ADENOSINE-3',5'-CYCLIC-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IVOMOUWHDPKRLL-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C4C(O3)COP(=O)(O4)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1SK6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1sk6A4e1sk6A5e1sk6A6e1sk6B1e1sk6B2e1sk6B3e1sk6C4e1sk6C5e1sk6C6e1sk6D1e1sk6D2e1sk6E1e1sk6E2e1sk6F1e1sk6F2
ECOD domains from experimental PDB structures interacting with ligand DB02527
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P40136 | DB02527 | CMP | 1sk6 | e1sk6A4 | A:349-489 |
| P40136 | DB02527 | CMP | 1sk6 | e1sk6A6 | A:292-348,A:490-630 |
| P40136 | DB02527 | CMP | 1sk6 | e1sk6B2 | B:348-488 |
| P40136 | DB02527 | CMP | 1sk6 | e1sk6B3 | B:294-347,B:489-629 |
| P40136 | DB02527 | CMP | 1sk6 | e1sk6C5 | C:349-489 |
| P40136 | DB02527 | CMP | 1sk6 | e1sk6C6 | C:292-348,C:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwA2 | A:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwA3 | A:289-348,A:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwB2 | B:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwB3 | B:289-348,B:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwC2 | C:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwC3 | C:289-348,C:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwD2 | D:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwD3 | D:289-348,D:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwE2 | E:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwE3 | E:289-348,E:490-630 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwF2 | F:349-489 |
| P40136 | DB02527 | CMP | 1xfw | e1xfwF3 | F:289-348,F:490-630 |