Attributes
UniProt ID
Protein Name
Sensory rhodopsin-2
Ligand Name
RETINAL
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NCYCYZXNIZJOKI-OVSJKPMPSA-N
SMILES
CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GU8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gu8A1
ECOD domains from experimental PDB structures interacting with ligand RET
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P42196 | n/a | RET | 1gu8 | e1gu8A1 | A:2-219 |
| P42196 | n/a | RET | 1gue | e1gueA1 | A:2-219 |
| P42196 | n/a | RET | 1h2s | e1h2sA1 | A:1-225 |
| P42196 | n/a | RET | 1h68 | e1h68A1 | A:2-218 |
| P42196 | n/a | RET | 1jgj | e1jgjA1 | A:1-217 |
| P42196 | n/a | RET | 2f93 | e2f93A1 | A:3-222 |
| P42196 | n/a | RET | 2f95 | e2f95A1 | A:3-222 |
| P42196 | n/a | RET | 3qap | e3qapA1 | A:1-219 |
| P42196 | n/a | RET | 3qdc | e3qdcA1 | A:1-219 |
| P42196 | n/a | RET | 4gyc | e4gycA1 | A:2-221 |
| P42196 | n/a | RET | 5jje | e5jjeA1 | A:2-222 |
| P42196 | n/a | RET | 5jjf | e5jjfA1 | A:2-222 |
| P42196 | n/a | RET | 5jjj | e5jjjA1 | A:3-218 |
| P42196 | n/a | RET | 5jjn | e5jjnA1 | A:3-225 |
| P42196 | n/a | RET | 5jjn | e5jjnC1 | C:3-217 |
| P42196 | n/a | RET | 7pnc | e7pncA1 | A:1-219 |
| P42196 | n/a | RET | 8qqo | e8qqoA1 | A:1-219 |