Attributes
UniProt ID
Protein Name
26S proteasome regulatory subunit 6B
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5GJQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5gjqB1e5gjqC1e5gjqD1e5gjqE1e5gjqF1e5gjqG1e5gjqH1e5gjqH3e5gjqI1e5gjqI2e5gjqI3e5gjqJ1e5gjqJ2e5gjqJ3e5gjqK1e5gjqK2e5gjqK3e5gjqL1e5gjqL2e5gjqL3e5gjqM1e5gjqM2e5gjqM3e5gjqM4e5gjqN1e5gjqN2e5gjqN3e5gjqO1e5gjqO2e5gjqO3e5gjqP1e5gjqP2e5gjqP3e5gjqQ1e5gjqQ2e5gjqQ3e5gjqR1e5gjqR2e5gjqR3e5gjqT1e5gjqT2e5gjqU2e5gjqU3e5gjqV1e5gjqV2e5gjqW1e5gjqX1e5gjqZ1e5gjqZ3e5gjqa1e5gjqb1e5gjqc1e5gjqd1e5gjqe1e5gjqf1e5gjqg1e5gjqh1e5gjqi1e5gjqj1e5gjqk1e5gjql1e5gjqm1e5gjqn1e5gjqo1e5gjqp1e5gjqq1e5gjqr1e5gjqs1e5gjqt1e5gjqu1e5gjqx1e5gjqy1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P43686 | DB16833 | ADP | 5gjq | e5gjqK2 | K:336-418 |
| P43686 | DB16833 | ADP | 5gjq | e5gjqK3 | K:146-335 |
| P43686 | DB16833 | ADP | 5gjr | e5gjrK2 | K:336-418 |
| P43686 | DB16833 | ADP | 5gjr | e5gjrK3 | K:146-335 |
| P43686 | DB16833 | ADP | 5gjr | e5gjry1 | y:146-335 |
| P43686 | DB16833 | ADP | 5gjr | e5gjry2 | y:336-418 |
| P43686 | DB16833 | ADP | 5m32 | e5m32e1 | e:146-335 |
| P43686 | DB16833 | ADP | 5m32 | e5m32e3 | e:336-418 |
| P43686 | DB16833 | ADP | 5t0h | e5t0hD1 | D:336-418 |
| P43686 | DB16833 | ADP | 5t0h | e5t0hD3 | D:146-335 |
| P43686 | DB16833 | ADP | 6msk | e6mskD2 | D:146-335 |
| P43686 | DB16833 | ADP | 6msk | e6mskD3 | D:336-418 |
| P43686 | DB16833 | ADP | 7qyb | e7qybD1 | D:336-418 |
| P43686 | DB16833 | ADP | 7qyb | e7qybD3 | D:146-335 |
| P43686 | DB16833 | ADP | 7w3g | e7w3gD1 | D:146-335 |
| P43686 | DB16833 | ADP | 7w3g | e7w3gD3 | D:336-418 |
| P43686 | DB16833 | ADP | 7w3h | e7w3hD1 | D:146-335 |
| P43686 | DB16833 | ADP | 7w3h | e7w3hD2 | D:336-418 |