Attributes
UniProt ID
Protein Name
ATP-dependent protease ATPase subunit HslU
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1G41
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1g41A1e1g41A2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P43773 | DB16833 | ADP | 1g41 | e1g41A1 | A:335-444 |
| P43773 | DB16833 | ADP | 1g41 | e1g41A2 | A:2-334 |
| P43773 | DB16833 | ADP | 1im2 | e1im2A1 | A:335-444 |
| P43773 | DB16833 | ADP | 1im2 | e1im2A2 | A:2-130,A:226-334 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhA1 | A:334-444 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhA2 | A:2-333 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhB1 | B:334-444 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhB2 | B:2-333 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhC1 | C:334-444 |
| P43773 | DB16833 | ADP | 1ofh | e1ofhC2 | C:2-333 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiA1 | A:334-444 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiA2 | A:2-333 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiB1 | B:334-444 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiB2 | B:2-333 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiC1 | C:334-444 |
| P43773 | DB16833 | ADP | 1ofi | e1ofiC2 | C:2-333 |