Attributes
UniProt ID
Protein Name
Sialic acid-binding periplasmic protein SiaP
Ligand Name
N-acetyl-beta-neuraminic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SQVRNKJHWKZAKO-PFQGKNLYSA-N
SMILES
CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2XA5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2xa5A1e2xa5A2
ECOD domains from experimental PDB structures interacting with ligand DB04265
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P44542 | DB04265 | SLB | 2xa5 | e2xa5A1 | A:125-213 |
| P44542 | DB04265 | SLB | 2xa5 | e2xa5A2 | A:1-124,A:214-310 |
| P44542 | DB04265 | SLB | 2xwi | e2xwiA1 | A:1-123,A:213-308 |
| P44542 | DB04265 | SLB | 2xwi | e2xwiA2 | A:124-212 |
| P44542 | DB04265 | SLB | 2xwk | e2xwkA1 | A:124-212 |
| P44542 | DB04265 | SLB | 2xwk | e2xwkA2 | A:1-123,A:213-309 |
| P44542 | DB04265 | SLB | 2xwv | e2xwvA1 | A:1-123,A:213-309 |
| P44542 | DB04265 | SLB | 2xwv | e2xwvA2 | A:124-212 |
| P44542 | DB04265 | SLB | 2xxk | e2xxkA1 | A:124-212 |
| P44542 | DB04265 | SLB | 2xxk | e2xxkA2 | A:1-123,A:213-308 |
| P44542 | DB04265 | SLB | 3b50 | e3b50A1 | A:1-123,A:213-310 |
| P44542 | DB04265 | SLB | 3b50 | e3b50A2 | A:124-212 |
| P44542 | DB04265 | SLB | 6h75 | e6h75A1 | A:1-124,A:214-308 |
| P44542 | DB04265 | SLB | 6h75 | e6h75A2 | A:125-213 |
| P44542 | DB04265 | SLB | 6h76 | e6h76A1 | A:1-123,A:213-308 |
| P44542 | DB04265 | SLB | 6h76 | e6h76A2 | A:124-212 |