Attributes
UniProt ID
Protein Name
NADP-dependent malic enzyme
Ligand Name
NADPH DIHYDRO-NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ACFIXJIJDZMPPO-NNYOXOHSSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)N5C=CCC(=C5)C(=O)N)O)O)O)OP(=O)(O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7X11
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7x11A1e7x11A2e7x11A3e7x11B1e7x11B2e7x11B3e7x11C1e7x11C2e7x11C3e7x11D1e7x11D2e7x11D3
ECOD domains from experimental PDB structures interacting with ligand DB02338
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P48163 | DB02338 | NDP | 7x11 | e7x11A1 | A:16-279 |
| P48163 | DB02338 | NDP | 7x11 | e7x11A2 | A:280-463 |
| P48163 | DB02338 | NDP | 7x11 | e7x11A3 | A:464-579 |
| P48163 | DB02338 | NDP | 7x11 | e7x11B1 | B:464-579 |
| P48163 | DB02338 | NDP | 7x11 | e7x11B2 | B:280-463 |
| P48163 | DB02338 | NDP | 7x11 | e7x11B3 | B:16-279 |
| P48163 | DB02338 | NDP | 7x11 | e7x11C1 | C:280-463 |
| P48163 | DB02338 | NDP | 7x11 | e7x11C2 | C:16-279 |
| P48163 | DB02338 | NDP | 7x11 | e7x11C3 | C:464-579 |
| P48163 | DB02338 | NDP | 7x11 | e7x11D1 | D:280-463 |
| P48163 | DB02338 | NDP | 7x11 | e7x11D2 | D:464-579 |
| P48163 | DB02338 | NDP | 7x11 | e7x11D3 | D:16-279 |
| P48163 | DB02338 | NDP | 7x12 | e7x12A1 | A:464-579 |
| P48163 | DB02338 | NDP | 7x12 | e7x12A2 | A:280-463 |
| P48163 | DB02338 | NDP | 7x12 | e7x12A3 | A:16-279 |
| P48163 | DB02338 | NDP | 7x12 | e7x12B1 | B:280-463 |
| P48163 | DB02338 | NDP | 7x12 | e7x12B2 | B:16-279 |
| P48163 | DB02338 | NDP | 7x12 | e7x12B3 | B:464-579 |
| P48163 | DB02338 | NDP | 7x12 | e7x12C1 | C:16-279 |
| P48163 | DB02338 | NDP | 7x12 | e7x12C2 | C:280-463 |
| P48163 | DB02338 | NDP | 7x12 | e7x12C3 | C:464-579 |
| P48163 | DB02338 | NDP | 7x12 | e7x12D1 | D:464-579 |
| P48163 | DB02338 | NDP | 7x12 | e7x12D2 | D:280-463 |
| P48163 | DB02338 | NDP | 7x12 | e7x12D3 | D:16-279 |