Attributes
UniProt ID
Protein Name
Ferripyoverdine receptor
Ligand Name
(1S)-1-CARBOXY-5-[(3-CARBOXYPROPANOYL)AMINO]-8,9-DIHYDROXY-1,2,3,4-TETRAHYDROPYRIMIDO[1,2-A]QUINOLIN-11-IUM
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PKIXPGNFUHEBHN-JTQLQIEISA-O
SMILES
c1c2cc(c(cc2[n+]3c(c1NC(=O)CCC(=O)O)NCCC3C(=O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XKH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xkhA1e1xkhA2e1xkhB1e1xkhB2e1xkhC1e1xkhC2
ECOD domains from experimental PDB structures interacting with ligand PVE
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P48632 | n/a | PVE | 1xkh | e1xkhA1 | A:129-152,A:274-815 |
| P48632 | n/a | PVE | 1xkh | e1xkhA2 | A:153-273 |
| P48632 | n/a | PVE | 1xkh | e1xkhB1 | B:129-152,B:274-815 |
| P48632 | n/a | PVE | 1xkh | e1xkhB2 | B:153-273 |
| P48632 | n/a | PVE | 1xkh | e1xkhC1 | C:153-273 |
| P48632 | n/a | PVE | 1xkh | e1xkhC2 | C:129-152,C:274-815 |
| P48632 | n/a | PVE | 2iah | e2iahA2 | A:139-273 |
| P48632 | n/a | PVE | 2iah | e2iahA3 | A:274-815 |
| P48632 | n/a | PVE | 2w16 | e2w16B2 | B:274-815 |
| P48632 | n/a | PVE | 2w16 | e2w16B4 | B:137-273 |
| P48632 | n/a | PVE | 2w6t | e2w6tB2 | B:274-815 |
| P48632 | n/a | PVE | 2w6t | e2w6tB4 | B:137-273 |
| P48632 | n/a | PVE | 2w6u | e2w6uB1 | B:137-273 |
| P48632 | n/a | PVE | 2w6u | e2w6uB2 | B:274-815 |
| P48632 | n/a | PVE | 2w76 | e2w76B1 | B:274-815 |
| P48632 | n/a | PVE | 2w76 | e2w76B4 | B:137-273 |
| P48632 | n/a | PVE | 2w77 | e2w77B2 | B:274-815 |
| P48632 | n/a | PVE | 2w77 | e2w77B4 | B:137-273 |
| P48632 | n/a | PVE | 2w78 | e2w78B1 | B:274-815 |
| P48632 | n/a | PVE | 2w78 | e2w78B4 | B:137-273 |