Attributes
UniProt ID
Protein Name
MAP kinase-activated protein kinase 2
Ligand Name
2-(2-QUINOLIN-3-YLPYRIDIN-4-YL)-1,5,6,7-TETRAHYDRO-4H-PYRROLO[3,2-C]PYRIDIN-4-ONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OWFLADWRSCINST-UHFFFAOYSA-N
SMILES
c1ccc2c(c1)cc(cn2)c3cc(ccn3)c4cc5c([nH]4)CCNC5=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2JBO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2jboA1
ECOD domains from experimental PDB structures interacting with ligand DB08358
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P49137 | DB08358 | P4O | 2jbo | e2jboA1 | A:44-347 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpA1 | A:46-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpB1 | B:46-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpC1 | C:46-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpD1 | D:47-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpE1 | E:44-345 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpF1 | F:45-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpG1 | G:45-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpH1 | H:46-347 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpI1 | I:45-350 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpK1 | K:47-214,K:241-345 |
| P49137 | DB08358 | P4O | 2jbp | e2jbpL1 | L:44-215,L:240-345 |
| P49137 | DB08358 | P4O | 3gok | e3gokA1 | A:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokB1 | B:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokC1 | C:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokD1 | D:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokE1 | E:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokF1 | F:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokG1 | G:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokH1 | H:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokI1 | I:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokJ1 | J:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokK1 | K:46-350 |
| P49137 | DB08358 | P4O | 3gok | e3gokL1 | L:46-350 |
| P49137 | DB08358 | P4O | 3r2y | e3r2yA1 | A:46-215,A:241-345 |