Attributes
UniProt ID
Protein Name
Deoxyhypusine synthase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1DHS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1dhsA1
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P49366 | DB14128 | NAD | 1dhs | e1dhsA1 | A:9-369 |
| P49366 | DB14128 | NAD | 1rlz | e1rlzA1 | A:9-369 |
| P49366 | DB14128 | NAD | 1roz | e1rozA1 | A:28-363 |
| P49366 | DB14128 | NAD | 1roz | e1rozB1 | B:28-363 |
| P49366 | DB14128 | NAD | 1rqd | e1rqdA1 | A:28-364 |
| P49366 | DB14128 | NAD | 1rqd | e1rqdB1 | B:28-363 |
| P49366 | DB14128 | NAD | 6p4v | e6p4vA1 | A:28-363 |
| P49366 | DB14128 | NAD | 6p4v | e6p4vB1 | B:28-363 |
| P49366 | DB14128 | NAD | 6xxi | e6xxiA1 | A:28-363 |
| P49366 | DB14128 | NAD | 6xxi | e6xxiB1 | B:28-370 |
| P49366 | DB14128 | NAD | 6xxj | e6xxjA1 | A:8-363 |
| P49366 | DB14128 | NAD | 6xxj | e6xxjB1 | B:28-363 |
| P49366 | DB14128 | NAD | 7a6t | e7a6tA1 | A:28-363 |
| P49366 | DB14128 | NAD | 7a6t | e7a6tB1 | B:28-364 |
| P49366 | DB14128 | NAD | 8a0e | e8a0eA1 | A:8-363 |
| P49366 | DB14128 | NAD | 8a0e | e8a0eB1 | B:8-363 |
| P49366 | DB14128 | NAD | 8a0e | e8a0eC1 | C:10-363 |
| P49366 | DB14128 | NAD | 8a0e | e8a0eD1 | D:28-363 |
| P49366 | DB14128 | NAD | 8a0f | e8a0fA1 | A:28-363 |
| P49366 | DB14128 | NAD | 8a0f | e8a0fB1 | B:28-363 |
| P49366 | DB14128 | NAD | 8a0g | e8a0gA1 | A:28-363 |
| P49366 | DB14128 | NAD | 8a0g | e8a0gB1 | B:9-363 |