Attributes
UniProt ID
Protein Name
Adenosine 5'-monophosphoramidase HINT1
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1KPF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1kpfA1
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P49773 | DB00131 | AMP | 1kpf | e1kpfA1 | A:16-126 |
| P49773 | DB00131 | AMP | 3tw2 | e3tw2A1 | A:11-126 |
| P49773 | DB00131 | AMP | 3tw2 | e3tw2B1 | B:15-126 |
| P49773 | DB00131 | AMP | 4zkl | e4zklA1 | A:15-126 |
| P49773 | DB00131 | AMP | 4zkl | e4zklB1 | B:13-126 |
| P49773 | DB00131 | AMP | 4zkl | e4zklC1 | C:15-126 |
| P49773 | DB00131 | AMP | 4zkl | e4zklD1 | D:14-126 |
| P49773 | DB00131 | AMP | 5ed3 | e5ed3A1 | A:14-126 |
| P49773 | DB00131 | AMP | 5ed3 | e5ed3B1 | B:12-126 |
| P49773 | DB00131 | AMP | 5ed6 | e5ed6A1 | A:14-126 |
| P49773 | DB00131 | AMP | 5ed6 | e5ed6B1 | B:12-126 |
| P49773 | DB00131 | AMP | 5klz | e5klzA1 | A:14-126 |
| P49773 | DB00131 | AMP | 5klz | e5klzB1 | B:12-126 |
| P49773 | DB00131 | AMP | 6j53 | e6j53A1 | A:14-126 |
| P49773 | DB00131 | AMP | 6j53 | e6j53B1 | B:12-126 |
| P49773 | DB00131 | AMP | 6j58 | e6j58A1 | A:13-126 |
| P49773 | DB00131 | AMP | 6j58 | e6j58B1 | B:12-126 |