Attributes
UniProt ID
Protein Name
Sulfotransferase 1A1
Ligand Name
ADENOSINE-3'-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WHTCPDAXWFLDIH-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)OP(=O)(O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LS6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ls6A1
ECOD domains from experimental PDB structures interacting with ligand DB01812
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P50225 | DB01812 | A3P | 1ls6 | e1ls6A1 | A:8-293 |
| P50225 | DB01812 | A3P | 1z28 | e1z28A1 | A:7-295 |
| P50225 | DB01812 | A3P | 2d06 | e2d06A1 | A:8-293 |
| P50225 | DB01812 | A3P | 2d06 | e2d06B1 | B:8-293 |
| P50225 | DB01812 | A3P | 3qvu | e3qvuA1 | A:8-295 |
| P50225 | DB01812 | A3P | 3qvu | e3qvuB1 | B:8-295 |
| P50225 | DB01812 | A3P | 3qvv | e3qvvA1 | A:8-295 |
| P50225 | DB01812 | A3P | 3qvv | e3qvvB1 | B:8-295 |
| P50225 | DB01812 | A3P | 3u3j | e3u3jA1 | A:8-294 |
| P50225 | DB01812 | A3P | 3u3j | e3u3jB1 | B:8-294 |
| P50225 | DB01812 | A3P | 3u3k | e3u3kA1 | A:7-295 |
| P50225 | DB01812 | A3P | 3u3k | e3u3kB1 | B:8-295 |
| P50225 | DB01812 | A3P | 3u3m | e3u3mA1 | A:7-295 |
| P50225 | DB01812 | A3P | 3u3o | e3u3oA1 | A:8-295 |
| P50225 | DB01812 | A3P | 3u3r | e3u3rA1 | A:8-295 |
| P50225 | DB01812 | A3P | 4gra | e4graA1 | A:8-295 |
| P50225 | DB01812 | A3P | 4gra | e4graB1 | B:-3-284 |