Attributes
UniProt ID
Protein Name
Photosystem II protein D1 protein
Ligand Name
heptyl 1-thio-beta-D-glucopyranoside
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HPEGNLMTTNTJSP-LBELIVKGSA-N
SMILES
CCCCCCCSC1C(C(C(C(O1)CO)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3WU2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3wu2A1e3wu2B1e3wu2B2e3wu2C1e3wu2D1e3wu2E1e3wu2F1e3wu2H1e3wu2I1e3wu2J1e3wu2K1e3wu2L1e3wu2M1e3wu2O1e3wu2T1e3wu2U1e3wu2V1e3wu2X1e3wu2Y1e3wu2Z1e3wu2a1e3wu2b1e3wu2b2e3wu2c1e3wu2d1e3wu2e1e3wu2f1e3wu2h1e3wu2i1e3wu2j1e3wu2k1e3wu2l1e3wu2m1e3wu2o1e3wu2t1e3wu2u1e3wu2v1e3wu2x1e3wu2y1e3wu2z1
ECOD domains from experimental PDB structures interacting with ligand DB04450
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P51765 | DB04450 | HTG | 3wu2 | e3wu2A1 | A:11-344 |
| P51765 | DB04450 | HTG | 4il6 | e4il6a2 | a:11-344 |
| P51765 | DB04450 | HTG | 4ub8 | e4ub8A1 | A:11-344 |
| P51765 | DB04450 | HTG | 5b5e | e5b5eA1 | A:11-344 |
| P51765 | DB04450 | HTG | 5b66 | e5b66A1 | A:11-344 |
| P51765 | DB04450 | HTG | 5v2c | e5v2cA1 | A:11-344 |
| P51765 | DB04450 | HTG | 5v2c | e5v2ca1 | a:11-344 |
| P51765 | DB04450 | HTG | 6jlp | e6jlpa1 | a:11-344 |
| P51765 | DB04450 | HTG | 7cji | e7cjiA1 | A:11-344 |
| P51765 | DB04450 | HTG | 7cji | e7cjia1 | a:11-344 |
| P51765 | DB04450 | HTG | 7cjj | e7cjjA1 | A:11-344 |
| P51765 | DB04450 | HTG | 7cjj | e7cjja1 | a:11-344 |
| P51765 | DB04450 | HTG | 7cou | e7couA1 | A:11-344 |
| P51765 | DB04450 | HTG | 7cou | e7coua1 | a:11-344 |
| P51765 | DB04450 | HTG | 8gn0 | e8gn0a1 | a:11-344 |
| P51765 | DB04450 | HTG | 8gn1 | e8gn1A1 | A:11-344 |
| P51765 | DB04450 | HTG | 8gn2 | e8gn2A1 | A:11-344 |
| P51765 | DB04450 | HTG | 8gn2 | e8gn2a1 | a:11-344 |