Attributes
UniProt ID
Protein Name
Spermine synthase
Ligand Name
5'-DEOXY-5'-METHYLTHIOADENOSINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WUUGFSXJNOTRMR-IOSLPCCCSA-N
SMILES
CSCC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3C6K
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3c6kA2e3c6kA3e3c6kA5e3c6kB2e3c6kB3e3c6kB5e3c6kC3e3c6kC4e3c6kC5e3c6kD2e3c6kD3e3c6kD5
ECOD domains from experimental PDB structures interacting with ligand DB02282
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P52788 | DB02282 | MTA | 3c6k | e3c6kA2 | A:176-367 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kA3 | A:108-175 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kB2 | B:176-368 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kB3 | B:108-175 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kC3 | C:108-175 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kC4 | C:176-368 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kD2 | D:176-367 |
| P52788 | DB02282 | MTA | 3c6k | e3c6kD3 | D:108-175 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mA2 | A:174-364 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mA3 | A:119-173 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mB3 | B:120-173 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mB4 | B:174-365 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mC1 | C:174-366 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mC2 | C:119-173 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mD1 | D:4-13,D:61-75,D:107-173 |
| P52788 | DB02282 | MTA | 3c6m | e3c6mD2 | D:174-364 |